C14H12ClNO2S — CID 51056962
3-[(3-chlorophenyl)methyl]-1,3-benzothiazol-2-one;hydrate (PubChem CID 51056962) has the molecular formula C14H12ClNO2S and a molecular weight of 293.78 g/mol. Its IUPAC name is 3-[(3-chlorophenyl)methyl]-1,3-benzothiazol-2-one;hydrate.
| Compound Name | 3-[(3-chlorophenyl)methyl]-1,3-benzothiazol-2-one;hydrate |
|---|---|
| PubChem CID | 51056962 |
| Molecular Formula | C14H12ClNO2S |
| Molecular Weight | 293.78 g/mol |
| Exact Mass | 293.03 |
| IUPAC Name | 3-[(3-chlorophenyl)methyl]-1,3-benzothiazol-2-one;hydrate |
| SMILES | O.O=c1sc2ccccc2n1Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C14H10ClNOS.H2O/c15-11-5-3-4-10(8-11)9-16-12-6-1-2-7-13(12)18-14(16)17;/h1-8H,9H2;1H2 |
| InChIKey | UEWQOKCHRTYISC-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 53.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.78 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |