C16H15NO4S — CID 51056964
(2-oxo-1,3-benzothiazol-3-yl)methyl 2-phenylacetate;hydrate (PubChem CID 51056964) has the molecular formula C16H15NO4S and a molecular weight of 317.37 g/mol. Its IUPAC name is (2-oxo-1,3-benzothiazol-3-yl)methyl 2-phenylacetate;hydrate.
| Compound Name | (2-oxo-1,3-benzothiazol-3-yl)methyl 2-phenylacetate;hydrate |
|---|---|
| PubChem CID | 51056964 |
| Molecular Formula | C16H15NO4S |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | (2-oxo-1,3-benzothiazol-3-yl)methyl 2-phenylacetate;hydrate |
| SMILES | O.O=C(Cc1ccccc1)OCn1c(=O)sc2ccccc21 |
| InChI | InChI=1S/C16H13NO3S.H2O/c18-15(10-12-6-2-1-3-7-12)20-11-17-13-8-4-5-9-14(13)21-16(17)19;/h1-9H,10-11H2;1H2 |
| InChIKey | HFRZYXHOXJVQHW-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 79.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |