C11H8Cl3NO3S — CID 4294591
2,2,2-trichloroethyl 2-(2-oxo-1,3-benzothiazol-3-yl)acetate (PubChem CID 4294591) has the molecular formula C11H8Cl3NO3S and a molecular weight of 340.62 g/mol. Its IUPAC name is 2,2,2-trichloroethyl 2-(2-oxo-1,3-benzothiazol-3-yl)acetate.
| Compound Name | 2,2,2-trichloroethyl 2-(2-oxo-1,3-benzothiazol-3-yl)acetate |
|---|---|
| PubChem CID | 4294591 |
| Molecular Formula | C11H8Cl3NO3S |
| Molecular Weight | 340.62 g/mol |
| Exact Mass | 338.93 |
| IUPAC Name | 2,2,2-trichloroethyl 2-(2-oxo-1,3-benzothiazol-3-yl)acetate |
| SMILES | O=C(Cn1c(=O)sc2ccccc21)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C11H8Cl3NO3S/c12-11(13,14)6-18-9(16)5-15-7-3-1-2-4-8(7)19-10(15)17/h1-4H,5-6H2 |
| InChIKey | BXEJPQGLNHHZSC-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.62 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|