C15H18N2O2S — CID 807438
3-[2-(azepan-1-yl)-2-oxoethyl]-1,3-benzothiazol-2-one (PubChem CID 807438) has the molecular formula C15H18N2O2S and a molecular weight of 290.39 g/mol. Its IUPAC name is 3-[2-(azepan-1-yl)-2-oxoethyl]-1,3-benzothiazol-2-one.
| Compound Name | 3-[2-(azepan-1-yl)-2-oxoethyl]-1,3-benzothiazol-2-one |
|---|---|
| PubChem CID | 807438 |
| Molecular Formula | C15H18N2O2S |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 3-[2-(azepan-1-yl)-2-oxoethyl]-1,3-benzothiazol-2-one |
| SMILES | O=C(Cn1c(=O)sc2ccccc21)N1CCCCCC1 |
| InChI | InChI=1S/C15H18N2O2S/c18-14(16-9-5-1-2-6-10-16)11-17-12-7-3-4-8-13(12)20-15(17)19/h3-4,7-8H,1-2,5-6,9-11H2 |
| InChIKey | OBFCGCBFQDADIY-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |