C13H14N4O3S — CID 21278839
3-[2-(4-nitrosopiperazin-1-yl)-2-oxoethyl]-1,3-benzothiazol-2-one (PubChem CID 21278839) has the molecular formula C13H14N4O3S and a molecular weight of 306.35 g/mol. Its IUPAC name is 3-[2-(4-nitrosopiperazin-1-yl)-2-oxoethyl]-1,3-benzothiazol-2-one.
| Compound Name | 3-[2-(4-nitrosopiperazin-1-yl)-2-oxoethyl]-1,3-benzothiazol-2-one |
|---|---|
| PubChem CID | 21278839 |
| Molecular Formula | C13H14N4O3S |
| Molecular Weight | 306.35 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | 3-[2-(4-nitrosopiperazin-1-yl)-2-oxoethyl]-1,3-benzothiazol-2-one |
| SMILES | O=NN1CCN(C(=O)Cn2c(=O)sc3ccccc32)CC1 |
| InChI | InChI=1S/C13H14N4O3S/c18-12(15-5-7-16(14-20)8-6-15)9-17-10-3-1-2-4-11(10)21-13(17)19/h1-4H,5-9H2 |
| InChIKey | VDMDBQXVWYVRNF-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 74.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.35 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|