C14H15F3N4O2S — CID 21278889
3-[2-(4-aminopiperazin-1-yl)-2-oxoethyl]-5-(trifluoromethyl)-1,3-benzothiazol-2-one (PubChem CID 21278889) has the molecular formula C14H15F3N4O2S and a molecular weight of 360.36 g/mol. Its IUPAC name is 3-[2-(4-aminopiperazin-1-yl)-2-oxoethyl]-5-(trifluoromethyl)-1,3-benzothiazol-2-one.
| Compound Name | 3-[2-(4-aminopiperazin-1-yl)-2-oxoethyl]-5-(trifluoromethyl)-1,3-benzothiazol-2-one |
|---|---|
| PubChem CID | 21278889 |
| Molecular Formula | C14H15F3N4O2S |
| Molecular Weight | 360.36 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | 3-[2-(4-aminopiperazin-1-yl)-2-oxoethyl]-5-(trifluoromethyl)-1,3-benzothiazol-2-one |
| SMILES | NN1CCN(C(=O)Cn2c(=O)sc3ccc(C(F)(F)F)cc32)CC1 |
| InChI | InChI=1S/C14H15F3N4O2S/c15-14(16,17)9-1-2-11-10(7-9)21(13(23)24-11)8-12(22)19-3-5-20(18)6-4-19/h1-2,7H,3-6,8,18H2 |
| InChIKey | UVWWVQJZNXWNFE-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 71.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.36 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|