C20H19N5O4S — CID 54027425
3-[2-[4-(benzylideneamino)piperazin-1-yl]-2-oxoethyl]-6-nitro-1,3-benzothiazol-2-one (PubChem CID 54027425) has the molecular formula C20H19N5O4S and a molecular weight of 425.47 g/mol. Its IUPAC name is 3-[2-[4-(benzylideneamino)piperazin-1-yl]-2-oxoethyl]-6-nitro-1,3-benzothiazol-2-one.
| Compound Name | 3-[2-[4-(benzylideneamino)piperazin-1-yl]-2-oxoethyl]-6-nitro-1,3-benzothiazol-2-one |
|---|---|
| PubChem CID | 54027425 |
| Molecular Formula | C20H19N5O4S |
| Molecular Weight | 425.47 g/mol |
| Exact Mass | 425.12 |
| IUPAC Name | 3-[2-[4-(benzylideneamino)piperazin-1-yl]-2-oxoethyl]-6-nitro-1,3-benzothiazol-2-one |
| SMILES | O=C(Cn1c(=O)sc2cc([N+](=O)[O-])ccc21)N1CCN(N=Cc2ccccc2)CC1 |
| InChI | InChI=1S/C20H19N5O4S/c26-19(14-24-17-7-6-16(25(28)29)12-18(17)30-20(24)27)22-8-10-23(11-9-22)21-13-15-4-2-1-3-5-15/h1-7,12-13H,8-11,14H2 |
| InChIKey | LDELGGAACPJXET-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 101.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.47 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_pipzn(79)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|