C10H8N2O4S — CID 676684
6-nitro-3-propanoyl-1,3-benzothiazol-2-one (PubChem CID 676684) has the molecular formula C10H8N2O4S and a molecular weight of 252.25 g/mol. Its IUPAC name is 6-nitro-3-propanoyl-1,3-benzothiazol-2-one.
| Compound Name | 6-nitro-3-propanoyl-1,3-benzothiazol-2-one |
|---|---|
| PubChem CID | 676684 |
| Molecular Formula | C10H8N2O4S |
| Molecular Weight | 252.25 g/mol |
| Exact Mass | 252.02 |
| IUPAC Name | 6-nitro-3-propanoyl-1,3-benzothiazol-2-one |
| SMILES | CCC(=O)n1c(=O)sc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C10H8N2O4S/c1-2-9(13)11-7-4-3-6(12(15)16)5-8(7)17-10(11)14/h3-5H,2H2,1H3 |
| InChIKey | CFVYLRNXNOMKLM-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 82.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.25 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|