C10H7N3O2S — CID 137320011
2-methyl-6-nitroimidazo[2,1-b][1,3]benzothiazole (PubChem CID 137320011) has the molecular formula C10H7N3O2S and a molecular weight of 233.25 g/mol. Its IUPAC name is 2-methyl-6-nitroimidazo[2,1-b][1,3]benzothiazole.
| Compound Name | 2-methyl-6-nitroimidazo[2,1-b][1,3]benzothiazole |
|---|---|
| PubChem CID | 137320011 |
| Molecular Formula | C10H7N3O2S |
| Molecular Weight | 233.25 g/mol |
| Exact Mass | 233.03 |
| IUPAC Name | 2-methyl-6-nitroimidazo[2,1-b][1,3]benzothiazole |
| SMILES | Cc1cn2c(n1)sc1cc([N+](=O)[O-])ccc12 |
| InChI | InChI=1S/C10H7N3O2S/c1-6-5-12-8-3-2-7(13(14)15)4-9(8)16-10(12)11-6/h2-5H,1H3 |
| InChIKey | FTZANZKAKKHVSV-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.25 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|