C16H10BrN3O2S — CID 19209671
2-(4-bromophenyl)-1-methyl-6-nitroimidazo[2,1-b][1,3]benzothiazole (PubChem CID 19209671) has the molecular formula C16H10BrN3O2S and a molecular weight of 388.25 g/mol. Its IUPAC name is 2-(4-bromophenyl)-1-methyl-6-nitroimidazo[2,1-b][1,3]benzothiazole.
| Compound Name | 2-(4-bromophenyl)-1-methyl-6-nitroimidazo[2,1-b][1,3]benzothiazole |
|---|---|
| PubChem CID | 19209671 |
| Molecular Formula | C16H10BrN3O2S |
| Molecular Weight | 388.25 g/mol |
| Exact Mass | 386.97 |
| IUPAC Name | 2-(4-bromophenyl)-1-methyl-6-nitroimidazo[2,1-b][1,3]benzothiazole |
| SMILES | Cc1c(-c2ccc(Br)cc2)nc2sc3cc([N+](=O)[O-])ccc3n12 |
| InChI | InChI=1S/C16H10BrN3O2S/c1-9-15(10-2-4-11(17)5-3-10)18-16-19(9)13-7-6-12(20(21)22)8-14(13)23-16/h2-8H,1H3 |
| InChIKey | BFJPQZBHKWHBQY-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.25 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|