C17H15N3O5S — CID 82036120
propan-2-yl 5-formyl-3-methyl-6-(4-nitrophenyl)imidazo[2,1-b][1,3]thiazole-2-carboxylate (PubChem CID 82036120) has the molecular formula C17H15N3O5S and a molecular weight of 373.39 g/mol. Its IUPAC name is propan-2-yl 5-formyl-3-methyl-6-(4-nitrophenyl)imidazo[2,1-b][1,3]thiazole-2-carboxylate.
| Compound Name | propan-2-yl 5-formyl-3-methyl-6-(4-nitrophenyl)imidazo[2,1-b][1,3]thiazole-2-carboxylate |
|---|---|
| PubChem CID | 82036120 |
| Molecular Formula | C17H15N3O5S |
| Molecular Weight | 373.39 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | propan-2-yl 5-formyl-3-methyl-6-(4-nitrophenyl)imidazo[2,1-b][1,3]thiazole-2-carboxylate |
| SMILES | Cc1c(C(=O)OC(C)C)sc2nc(-c3ccc([N+](=O)[O-])cc3)c(C=O)n12 |
| InChI | InChI=1S/C17H15N3O5S/c1-9(2)25-16(22)15-10(3)19-13(8-21)14(18-17(19)26-15)11-4-6-12(7-5-11)20(23)24/h4-9H,1-3H3 |
| InChIKey | IRWMTZGWJIFMIC-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.39 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|