C19H13N3O4S — CID 39198698
6-(3-methoxyphenyl)-3-(3-nitrophenyl)imidazo[2,1-b][1,3]thiazole-5-carbaldehyde (PubChem CID 39198698) has the molecular formula C19H13N3O4S and a molecular weight of 379.40 g/mol. Its IUPAC name is 6-(3-methoxyphenyl)-3-(3-nitrophenyl)imidazo[2,1-b][1,3]thiazole-5-carbaldehyde.
| Compound Name | 6-(3-methoxyphenyl)-3-(3-nitrophenyl)imidazo[2,1-b][1,3]thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 39198698 |
| Molecular Formula | C19H13N3O4S |
| Molecular Weight | 379.40 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | 6-(3-methoxyphenyl)-3-(3-nitrophenyl)imidazo[2,1-b][1,3]thiazole-5-carbaldehyde |
| SMILES | COc1cccc(-c2nc3scc(-c4cccc([N+](=O)[O-])c4)n3c2C=O)c1 |
| InChI | InChI=1S/C19H13N3O4S/c1-26-15-7-3-5-13(9-15)18-16(10-23)21-17(11-27-19(21)20-18)12-4-2-6-14(8-12)22(24)25/h2-11H,1H3 |
| InChIKey | AYOCSEHEGYYXMF-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.40 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|