C18H11N3O4S — CID 82035378
3-(3-nitrophenyl)-6-phenylimidazo[2,1-b][1,3]thiazole-5-carboxylic acid (PubChem CID 82035378) has the molecular formula C18H11N3O4S and a molecular weight of 365.37 g/mol. Its IUPAC name is 3-(3-nitrophenyl)-6-phenylimidazo[2,1-b][1,3]thiazole-5-carboxylic acid.
| Compound Name | 3-(3-nitrophenyl)-6-phenylimidazo[2,1-b][1,3]thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 82035378 |
| Molecular Formula | C18H11N3O4S |
| Molecular Weight | 365.37 g/mol |
| Exact Mass | 365.05 |
| IUPAC Name | 3-(3-nitrophenyl)-6-phenylimidazo[2,1-b][1,3]thiazole-5-carboxylic acid |
| SMILES | O=C(O)c1c(-c2ccccc2)nc2scc(-c3cccc([N+](=O)[O-])c3)n12 |
| InChI | InChI=1S/C18H11N3O4S/c22-17(23)16-15(11-5-2-1-3-6-11)19-18-20(16)14(10-26-18)12-7-4-8-13(9-12)21(24)25/h1-10H,(H,22,23) |
| InChIKey | DMYSJDFHUBULPA-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.37 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|