C24H14N4O2S — CID 101436709
9-(4-nitrophenyl)-12-phenyl-14-thia-8,11,16-triazatetracyclo[8.6.0.02,7.011,15]hexadeca-1(10),2,4,6,8,12,15-heptaene (PubChem CID 101436709) has the molecular formula C24H14N4O2S and a molecular weight of 422.47 g/mol. Its IUPAC name is 9-(4-nitrophenyl)-12-phenyl-14-thia-8,11,16-triazatetracyclo[8.6.0.02,7.011,15]hexadeca-1(10),2,4,6,8,12,15-heptaene.
| Compound Name | 9-(4-nitrophenyl)-12-phenyl-14-thia-8,11,16-triazatetracyclo[8.6.0.02,7.011,15]hexadeca-1(10),2,4,6,8,12,15-heptaene |
|---|---|
| PubChem CID | 101436709 |
| Molecular Formula | C24H14N4O2S |
| Molecular Weight | 422.47 g/mol |
| Exact Mass | 422.08 |
| IUPAC Name | 9-(4-nitrophenyl)-12-phenyl-14-thia-8,11,16-triazatetracyclo[8.6.0.02,7.011,15]hexadeca-1(10),2,4,6,8,12,15-heptaene |
| SMILES | O=[N+]([O-])c1ccc(-c2nc3ccccc3c3nc4scc(-c5ccccc5)n4c23)cc1 |
| InChI | InChI=1S/C24H14N4O2S/c29-28(30)17-12-10-16(11-13-17)21-23-22(18-8-4-5-9-19(18)25-21)26-24-27(23)20(14-31-24)15-6-2-1-3-7-15/h1-14H |
| InChIKey | HJESYIHXLFDEQB-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 73.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.47 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|