C25H15N5O2 — CID 15867137
4-naphthalen-2-yl-3-(4-nitrophenyl)triazolo[4,5-c]quinoline (PubChem CID 15867137) has the molecular formula C25H15N5O2 and a molecular weight of 417.43 g/mol. Its IUPAC name is 4-naphthalen-2-yl-3-(4-nitrophenyl)triazolo[4,5-c]quinoline.
| Compound Name | 4-naphthalen-2-yl-3-(4-nitrophenyl)triazolo[4,5-c]quinoline |
|---|---|
| PubChem CID | 15867137 |
| Molecular Formula | C25H15N5O2 |
| Molecular Weight | 417.43 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | 4-naphthalen-2-yl-3-(4-nitrophenyl)triazolo[4,5-c]quinoline |
| SMILES | O=[N+]([O-])c1ccc(-n2nnc3c4ccccc4nc(-c4ccc5ccccc5c4)c32)cc1 |
| InChI | InChI=1S/C25H15N5O2/c31-30(32)20-13-11-19(12-14-20)29-25-23(18-10-9-16-5-1-2-6-17(16)15-18)26-22-8-4-3-7-21(22)24(25)27-28-29/h1-15H |
| InChIKey | XYYCLUVLQGQWSO-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.43 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|