C20H16N4O2 — CID 45139334
N,N-dimethyl-5-(4-nitrophenyl)benzo[h][1,6]naphthyridin-2-amine (PubChem CID 45139334) has the molecular formula C20H16N4O2 and a molecular weight of 344.37 g/mol. Its IUPAC name is N,N-dimethyl-5-(4-nitrophenyl)benzo[h][1,6]naphthyridin-2-amine.
| Compound Name | N,N-dimethyl-5-(4-nitrophenyl)benzo[h][1,6]naphthyridin-2-amine |
|---|---|
| PubChem CID | 45139334 |
| Molecular Formula | C20H16N4O2 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | N,N-dimethyl-5-(4-nitrophenyl)benzo[h][1,6]naphthyridin-2-amine |
| SMILES | CN(C)c1ccc2c(-c3ccc([N+](=O)[O-])cc3)nc3ccccc3c2n1 |
| InChI | InChI=1S/C20H16N4O2/c1-23(2)18-12-11-16-19(13-7-9-14(10-8-13)24(25)26)21-17-6-4-3-5-15(17)20(16)22-18/h3-12H,1-2H3 |
| InChIKey | RLMRLLKPBDPADD-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 72.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|