C20H10N4O5S — CID 23965363
2-[3-(3-nitrophenyl)-7-oxo-[1,3]thiazolo[3,2-a]pyrimidin-6-yl]isoindole-1,3-dione (PubChem CID 23965363) has the molecular formula C20H10N4O5S and a molecular weight of 418.39 g/mol. Its IUPAC name is 2-[3-(3-nitrophenyl)-7-oxo-[1,3]thiazolo[3,2-a]pyrimidin-6-yl]isoindole-1,3-dione.
| Compound Name | 2-[3-(3-nitrophenyl)-7-oxo-[1,3]thiazolo[3,2-a]pyrimidin-6-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 23965363 |
| Molecular Formula | C20H10N4O5S |
| Molecular Weight | 418.39 g/mol |
| Exact Mass | 418.04 |
| IUPAC Name | 2-[3-(3-nitrophenyl)-7-oxo-[1,3]thiazolo[3,2-a]pyrimidin-6-yl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1c1cn2c(-c3cccc([N+](=O)[O-])c3)csc2nc1=O |
| InChI | InChI=1S/C20H10N4O5S/c25-17-15(23-18(26)13-6-1-2-7-14(13)19(23)27)9-22-16(10-30-20(22)21-17)11-4-3-5-12(8-11)24(28)29/h1-10H |
| InChIKey | LZAXLEUKHJAHHC-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 114.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.39 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|