C13H11N5O3S — CID 10041509
2-[6-(3-nitrophenyl)imidazo[2,1-b][1,3]thiazol-3-yl]acetohydrazide (PubChem CID 10041509) has the molecular formula C13H11N5O3S and a molecular weight of 317.33 g/mol. Its IUPAC name is 2-[6-(3-nitrophenyl)imidazo[2,1-b][1,3]thiazol-3-yl]acetohydrazide.
| Compound Name | 2-[6-(3-nitrophenyl)imidazo[2,1-b][1,3]thiazol-3-yl]acetohydrazide |
|---|---|
| PubChem CID | 10041509 |
| Molecular Formula | C13H11N5O3S |
| Molecular Weight | 317.33 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | 2-[6-(3-nitrophenyl)imidazo[2,1-b][1,3]thiazol-3-yl]acetohydrazide |
| SMILES | NNC(=O)Cc1csc2nc(-c3cccc([N+](=O)[O-])c3)cn12 |
| InChI | InChI=1S/C13H11N5O3S/c14-16-12(19)5-10-7-22-13-15-11(6-17(10)13)8-2-1-3-9(4-8)18(20)21/h1-4,6-7H,5,14H2,(H,16,19) |
| InChIKey | IATCLJQUHOSTOK-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.33 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|