C21H15N5O3S — CID 154758998
N-(5-cyano-2-methyl-4-nitrophenyl)-2-(6-phenylimidazo[2,1-b][1,3]thiazol-3-yl)acetamide (PubChem CID 154758998) has the molecular formula C21H15N5O3S and a molecular weight of 417.45 g/mol. Its IUPAC name is N-(5-cyano-2-methyl-4-nitrophenyl)-2-(6-phenylimidazo[2,1-b][1,3]thiazol-3-yl)acetamide.
| Compound Name | N-(5-cyano-2-methyl-4-nitrophenyl)-2-(6-phenylimidazo[2,1-b][1,3]thiazol-3-yl)acetamide |
|---|---|
| PubChem CID | 154758998 |
| Molecular Formula | C21H15N5O3S |
| Molecular Weight | 417.45 g/mol |
| Exact Mass | 417.09 |
| IUPAC Name | N-(5-cyano-2-methyl-4-nitrophenyl)-2-(6-phenylimidazo[2,1-b][1,3]thiazol-3-yl)acetamide |
| SMILES | Cc1cc([N+](=O)[O-])c(C#N)cc1NC(=O)Cc1csc2nc(-c3ccccc3)cn12 |
| InChI | InChI=1S/C21H15N5O3S/c1-13-7-19(26(28)29)15(10-22)8-17(13)23-20(27)9-16-12-30-21-24-18(11-25(16)21)14-5-3-2-4-6-14/h2-8,11-12H,9H2,1H3,(H,23,27) |
| InChIKey | OEBDIYBBJGRQCB-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 113.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.45 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|