About N-(2-cyanophenyl)-2-[6-(4-fluorophenyl)imidazo[2,1-b][1,3]thiazol-3-yl]acetamide
N-(2-cyanophenyl)-2-[6-(4-fluorophenyl)imidazo[2,1-b][1,3]thiazol-3-yl]acetamide (PubChem CID 121038239) has the molecular formula C20H13FN4OS
and a molecular weight of 376.42 g/mol. Its IUPAC name is N-(2-cyanophenyl)-2-[6-(4-fluorophenyl)imidazo[2,1-b][1,3]thiazol-3-yl]acetamide.
Molecular Properties
| Compound Name | N-(2-cyanophenyl)-2-[6-(4-fluorophenyl)imidazo[2,1-b][1,3]thiazol-3-yl]acetamide |
| PubChem CID | 121038239 |
| Molecular Formula | C20H13FN4OS |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | N-(2-cyanophenyl)-2-[6-(4-fluorophenyl)imidazo[2,1-b][1,3]thiazol-3-yl]acetamide |
| SMILES | N#Cc1ccccc1NC(=O)Cc1csc2nc(-c3ccc(F)cc3)cn12 |
| InChI | InChI=1S/C20H13FN4OS/c21-15-7-5-13(6-8-15)18-11-25-16(12-27-20(25)24-18)9-19(26)23-17-4-2-1-3-14(17)10-22/h1-8,11-12H,9H2,(H,23,26) |
| InChIKey | RNQHYZNWMRQEAI-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 70.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(2-cyanophenyl)-2-[6-(4-fluorophenyl)imidazo[2,1-b][1,3]thiazol-3-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-cyanophenyl)-2-[6-(4-fluorophenyl)imidazo[2,1-b][1,3]thiazol-3-yl]acetamide?
The IUPAC name of N-(2-cyanophenyl)-2-[6-(4-fluorophenyl)imidazo[2,1-b][1,3]thiazol-3-yl]acetamide (CID 121038239) is N-(2-cyanophenyl)-2-[6-(4-fluorophenyl)imidazo[2,1-b][1,3]thiazol-3-yl]acetamide.
What is the SMILES notation for N-(2-cyanophenyl)-2-[6-(4-fluorophenyl)imidazo[2,1-b][1,3]thiazol-3-yl]acetamide?
The canonical SMILES for N-(2-cyanophenyl)-2-[6-(4-fluorophenyl)imidazo[2,1-b][1,3]thiazol-3-yl]acetamide is N#Cc1ccccc1NC(=O)Cc1csc2nc(-c3ccc(F)cc3)cn12.
What is the InChIKey of N-(2-cyanophenyl)-2-[6-(4-fluorophenyl)imidazo[2,1-b][1,3]thiazol-3-yl]acetamide?
The InChIKey is RNQHYZNWMRQEAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H13FN4OS/c21-15-7-5-13(6-8-15)18-11-25-16(12-27-20(25)24-18)9-19(26)23-17-4-2-1-3-14(17)10-22/h1-8,11-12H,9H2,(H,23,26).
What are the key properties of N-(2-cyanophenyl)-2-[6-(4-fluorophenyl)imidazo[2,1-b][1,3]thiazol-3-yl]acetamide?
N-(2-cyanophenyl)-2-[6-(4-fluorophenyl)imidazo[2,1-b][1,3]thiazol-3-yl]acetamide has a molecular weight of 376.42 g/mol, XLogP of 4.25, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-cyanophenyl)-2-[6-(4-fluorophenyl)imidazo[2,1-b][1,3]thiazol-3-yl]acetamide is sourced from PubChem (CID 121038239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).