C20H12ClN5O3S — CID 121038487
2-[6-(4-chlorophenyl)imidazo[2,1-b][1,3]thiazol-3-yl]-N-(2-cyano-4-nitrophenyl)acetamide (PubChem CID 121038487) has the molecular formula C20H12ClN5O3S and a molecular weight of 437.87 g/mol. Its IUPAC name is 2-[6-(4-chlorophenyl)imidazo[2,1-b][1,3]thiazol-3-yl]-N-(2-cyano-4-nitrophenyl)acetamide.
| Compound Name | 2-[6-(4-chlorophenyl)imidazo[2,1-b][1,3]thiazol-3-yl]-N-(2-cyano-4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 121038487 |
| Molecular Formula | C20H12ClN5O3S |
| Molecular Weight | 437.87 g/mol |
| Exact Mass | 437.03 |
| IUPAC Name | 2-[6-(4-chlorophenyl)imidazo[2,1-b][1,3]thiazol-3-yl]-N-(2-cyano-4-nitrophenyl)acetamide |
| SMILES | N#Cc1cc([N+](=O)[O-])ccc1NC(=O)Cc1csc2nc(-c3ccc(Cl)cc3)cn12 |
| InChI | InChI=1S/C20H12ClN5O3S/c21-14-3-1-12(2-4-14)18-10-25-16(11-30-20(25)24-18)8-19(27)23-17-6-5-15(26(28)29)7-13(17)9-22/h1-7,10-11H,8H2,(H,23,27) |
| InChIKey | PPMZBTWPDXKDHY-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 113.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.87 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|