C11H9N5O2S — CID 82105489
[5-(3-nitrophenyl)-[1,3]thiazolo[2,3-c][1,2,4]triazol-3-yl]methanamine (PubChem CID 82105489) has the molecular formula C11H9N5O2S and a molecular weight of 275.29 g/mol. Its IUPAC name is [5-(3-nitrophenyl)-[1,3]thiazolo[2,3-c][1,2,4]triazol-3-yl]methanamine.
| Compound Name | [5-(3-nitrophenyl)-[1,3]thiazolo[2,3-c][1,2,4]triazol-3-yl]methanamine |
|---|---|
| PubChem CID | 82105489 |
| Molecular Formula | C11H9N5O2S |
| Molecular Weight | 275.29 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | [5-(3-nitrophenyl)-[1,3]thiazolo[2,3-c][1,2,4]triazol-3-yl]methanamine |
| SMILES | NCc1nnc2scc(-c3cccc([N+](=O)[O-])c3)n12 |
| InChI | InChI=1S/C11H9N5O2S/c12-5-10-13-14-11-15(10)9(6-19-11)7-2-1-3-8(4-7)16(17)18/h1-4,6H,5,12H2 |
| InChIKey | MMOIFKOMCKHPFX-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 99.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.29 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|