C15H9N3O4S — CID 45142332
2,4-bis(3-nitrophenyl)-1,3-thiazole (PubChem CID 45142332) has the molecular formula C15H9N3O4S and a molecular weight of 327.32 g/mol. Its IUPAC name is 2,4-bis(3-nitrophenyl)-1,3-thiazole.
| Compound Name | 2,4-bis(3-nitrophenyl)-1,3-thiazole |
|---|---|
| PubChem CID | 45142332 |
| Molecular Formula | C15H9N3O4S |
| Molecular Weight | 327.32 g/mol |
| Exact Mass | 327.03 |
| IUPAC Name | 2,4-bis(3-nitrophenyl)-1,3-thiazole |
| SMILES | O=[N+]([O-])c1cccc(-c2csc(-c3cccc([N+](=O)[O-])c3)n2)c1 |
| InChI | InChI=1S/C15H9N3O4S/c19-17(20)12-5-1-3-10(7-12)14-9-23-15(16-14)11-4-2-6-13(8-11)18(21)22/h1-9H |
| InChIKey | PHWMYZJDTTYAOE-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 99.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.32 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|