C11H11BrN2O3S — CID 176652782
2-bromo-4-(3-nitrophenyl)-1,3-thiazole;ethanol (PubChem CID 176652782) has the molecular formula C11H11BrN2O3S and a molecular weight of 331.19 g/mol. Its IUPAC name is 2-bromo-4-(3-nitrophenyl)-1,3-thiazole;ethanol.
| Compound Name | 2-bromo-4-(3-nitrophenyl)-1,3-thiazole;ethanol |
|---|---|
| PubChem CID | 176652782 |
| Molecular Formula | C11H11BrN2O3S |
| Molecular Weight | 331.19 g/mol |
| Exact Mass | 329.97 |
| IUPAC Name | 2-bromo-4-(3-nitrophenyl)-1,3-thiazole;ethanol |
| SMILES | CCO.O=[N+]([O-])c1cccc(-c2csc(Br)n2)c1 |
| InChI | InChI=1S/C9H5BrN2O2S.C2H6O/c10-9-11-8(5-15-9)6-2-1-3-7(4-6)12(13)14;1-2-3/h1-5H;3H,2H2,1H3 |
| InChIKey | ZJXULZDSWHJDEG-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 76.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.19 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|