C10H8N3O4S2- — CID 90138603
2-[methyl(sulfinato)amino]-4-(3-nitrophenyl)-1,3-thiazole (PubChem CID 90138603) has the molecular formula C10H8N3O4S2- and a molecular weight of 298.33 g/mol. Its IUPAC name is 2-[methyl(sulfinato)amino]-4-(3-nitrophenyl)-1,3-thiazole.
| Compound Name | 2-[methyl(sulfinato)amino]-4-(3-nitrophenyl)-1,3-thiazole |
|---|---|
| PubChem CID | 90138603 |
| Molecular Formula | C10H8N3O4S2- |
| Molecular Weight | 298.33 g/mol |
| Exact Mass | 298.00 |
| IUPAC Name | 2-[methyl(sulfinato)amino]-4-(3-nitrophenyl)-1,3-thiazole |
| SMILES | CN(c1nc(-c2cccc([N+](=O)[O-])c2)cs1)S(=O)[O-] |
| InChI | InChI=1S/C10H9N3O4S2/c1-12(19(16)17)10-11-9(6-18-10)7-3-2-4-8(5-7)13(14)15/h2-6H,1H3,(H,16,17)/p-1 |
| InChIKey | DFPSTFBDMLQKNR-UHFFFAOYSA-M |
| XLogP | 1.95 |
| TPSA | 99.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.33 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|