C23H18BrClN4O2S — CID 45045947
N-[(E)-1-(4-chlorophenyl)ethylideneamino]-4-(3-nitrophenyl)-N-phenyl-1,3-thiazol-2-amine;hydrobromide (PubChem CID 45045947) has the molecular formula C23H18BrClN4O2S and a molecular weight of 529.85 g/mol. Its IUPAC name is N-[(E)-1-(4-chlorophenyl)ethylideneamino]-4-(3-nitrophenyl)-N-phenyl-1,3-thiazol-2-amine;hydrobromide.
| Compound Name | N-[(E)-1-(4-chlorophenyl)ethylideneamino]-4-(3-nitrophenyl)-N-phenyl-1,3-thiazol-2-amine;hydrobromide |
|---|---|
| PubChem CID | 45045947 |
| Molecular Formula | C23H18BrClN4O2S |
| Molecular Weight | 529.85 g/mol |
| Exact Mass | 528.00 |
| IUPAC Name | N-[(E)-1-(4-chlorophenyl)ethylideneamino]-4-(3-nitrophenyl)-N-phenyl-1,3-thiazol-2-amine;hydrobromide |
| SMILES | Br.C/C(=N\N(c1ccccc1)c1nc(-c2cccc([N+](=O)[O-])c2)cs1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H17ClN4O2S.BrH/c1-16(17-10-12-19(24)13-11-17)26-27(20-7-3-2-4-8-20)23-25-22(15-31-23)18-6-5-9-21(14-18)28(29)30;/h2-15H,1H3;1H/b26-16+; |
| InChIKey | FYNNLZKVUBSNOX-SAVLHYOGSA-N |
| XLogP | 7.51 |
| TPSA | 71.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.85 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|