About N-[(E)-1-(4-chlorophenyl)ethylideneamino]-N,4-diphenyl-1,3-thiazol-2-amine
N-[(E)-1-(4-chlorophenyl)ethylideneamino]-N,4-diphenyl-1,3-thiazol-2-amine (PubChem CID 45045946) has the molecular formula C23H18ClN3S
and a molecular weight of 403.94 g/mol. Its IUPAC name is N-[(E)-1-(4-chlorophenyl)ethylideneamino]-N,4-diphenyl-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | N-[(E)-1-(4-chlorophenyl)ethylideneamino]-N,4-diphenyl-1,3-thiazol-2-amine |
| PubChem CID | 45045946 |
| Molecular Formula | C23H18ClN3S |
| Molecular Weight | 403.94 g/mol |
| Exact Mass | 403.09 |
| IUPAC Name | N-[(E)-1-(4-chlorophenyl)ethylideneamino]-N,4-diphenyl-1,3-thiazol-2-amine |
| SMILES | C/C(=N\N(c1ccccc1)c1nc(-c2ccccc2)cs1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H18ClN3S/c1-17(18-12-14-20(24)15-13-18)26-27(21-10-6-3-7-11-21)23-25-22(16-28-23)19-8-4-2-5-9-19/h2-16H,1H3/b26-17+ |
| InChIKey | CNUOVIYTHDKFKJ-YZSQISJMSA-N |
| XLogP | 7.03 |
| TPSA | 28.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 403.94 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(E)-1-(4-chlorophenyl)ethylideneamino]-N,4-diphenyl-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(E)-1-(4-chlorophenyl)ethylideneamino]-N,4-diphenyl-1,3-thiazol-2-amine?
The IUPAC name of N-[(E)-1-(4-chlorophenyl)ethylideneamino]-N,4-diphenyl-1,3-thiazol-2-amine (CID 45045946) is N-[(E)-1-(4-chlorophenyl)ethylideneamino]-N,4-diphenyl-1,3-thiazol-2-amine.
What is the SMILES notation for N-[(E)-1-(4-chlorophenyl)ethylideneamino]-N,4-diphenyl-1,3-thiazol-2-amine?
The canonical SMILES for N-[(E)-1-(4-chlorophenyl)ethylideneamino]-N,4-diphenyl-1,3-thiazol-2-amine is C/C(=N\N(c1ccccc1)c1nc(-c2ccccc2)cs1)c1ccc(Cl)cc1.
What is the InChIKey of N-[(E)-1-(4-chlorophenyl)ethylideneamino]-N,4-diphenyl-1,3-thiazol-2-amine?
The InChIKey is CNUOVIYTHDKFKJ-YZSQISJMSA-N. The full InChI is InChI=1S/C23H18ClN3S/c1-17(18-12-14-20(24)15-13-18)26-27(21-10-6-3-7-11-21)23-25-22(16-28-23)19-8-4-2-5-9-19/h2-16H,1H3/b26-17+.
What are the key properties of N-[(E)-1-(4-chlorophenyl)ethylideneamino]-N,4-diphenyl-1,3-thiazol-2-amine?
N-[(E)-1-(4-chlorophenyl)ethylideneamino]-N,4-diphenyl-1,3-thiazol-2-amine has a molecular weight of 403.94 g/mol, XLogP of 7.03, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(E)-1-(4-chlorophenyl)ethylideneamino]-N,4-diphenyl-1,3-thiazol-2-amine is sourced from PubChem (CID 45045946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).