C23H18ClN3S — CID 45045946
N-[(E)-1-(4-chlorophenyl)ethylideneamino]-N,4-diphenyl-1,3-thiazol-2-amine (PubChem CID 45045946) has the molecular formula C23H18ClN3S and a molecular weight of 403.94 g/mol. Its IUPAC name is N-[(E)-1-(4-chlorophenyl)ethylideneamino]-N,4-diphenyl-1,3-thiazol-2-amine.
| Compound Name | N-[(E)-1-(4-chlorophenyl)ethylideneamino]-N,4-diphenyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 45045946 |
| Molecular Formula | C23H18ClN3S |
| Molecular Weight | 403.94 g/mol |
| Exact Mass | 403.09 |
| IUPAC Name | N-[(E)-1-(4-chlorophenyl)ethylideneamino]-N,4-diphenyl-1,3-thiazol-2-amine |
| SMILES | C/C(=N\N(c1ccccc1)c1nc(-c2ccccc2)cs1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H18ClN3S/c1-17(18-12-14-20(24)15-13-18)26-27(21-10-6-3-7-11-21)23-25-22(16-28-23)19-8-4-2-5-9-19/h2-16H,1H3/b26-17+ |
| InChIKey | CNUOVIYTHDKFKJ-YZSQISJMSA-N |
| XLogP | 7.03 |
| TPSA | 28.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.94 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|