C22H16N4O3S — CID 68604161
4-nitro-N'-phenyl-N'-(4-phenyl-1,3-thiazol-2-yl)benzohydrazide (PubChem CID 68604161) has the molecular formula C22H16N4O3S and a molecular weight of 416.46 g/mol. Its IUPAC name is 4-nitro-N'-phenyl-N'-(4-phenyl-1,3-thiazol-2-yl)benzohydrazide.
| Compound Name | 4-nitro-N'-phenyl-N'-(4-phenyl-1,3-thiazol-2-yl)benzohydrazide |
|---|---|
| PubChem CID | 68604161 |
| Molecular Formula | C22H16N4O3S |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.09 |
| IUPAC Name | 4-nitro-N'-phenyl-N'-(4-phenyl-1,3-thiazol-2-yl)benzohydrazide |
| SMILES | O=C(NN(c1ccccc1)c1nc(-c2ccccc2)cs1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H16N4O3S/c27-21(17-11-13-19(14-12-17)26(28)29)24-25(18-9-5-2-6-10-18)22-23-20(15-30-22)16-7-3-1-4-8-16/h1-15H,(H,24,27) |
| InChIKey | WGPYLOBKPOKJLJ-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 88.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|