C27H19N3O4S — CID 4843850
N-(2-methoxyphenyl)-N-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]naphthalene-2-carboxamide (PubChem CID 4843850) has the molecular formula C27H19N3O4S and a molecular weight of 481.53 g/mol. Its IUPAC name is N-(2-methoxyphenyl)-N-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]naphthalene-2-carboxamide.
| Compound Name | N-(2-methoxyphenyl)-N-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 4843850 |
| Molecular Formula | C27H19N3O4S |
| Molecular Weight | 481.53 g/mol |
| Exact Mass | 481.11 |
| IUPAC Name | N-(2-methoxyphenyl)-N-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]naphthalene-2-carboxamide |
| SMILES | COc1ccccc1N(C(=O)c1ccc2ccccc2c1)c1nc(-c2ccc([N+](=O)[O-])cc2)cs1 |
| InChI | InChI=1S/C27H19N3O4S/c1-34-25-9-5-4-8-24(25)29(26(31)21-11-10-18-6-2-3-7-20(18)16-21)27-28-23(17-35-27)19-12-14-22(15-13-19)30(32)33/h2-17H,1H3 |
| InChIKey | VVKNEKRUTUYKGO-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 85.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.53 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|