C20H14N4O4S — CID 19176240
(E)-2-cyano-3-(2-methoxyphenyl)-N-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]prop-2-enamide (PubChem CID 19176240) has the molecular formula C20H14N4O4S and a molecular weight of 406.42 g/mol. Its IUPAC name is (E)-2-cyano-3-(2-methoxyphenyl)-N-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]prop-2-enamide.
| Compound Name | (E)-2-cyano-3-(2-methoxyphenyl)-N-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 19176240 |
| Molecular Formula | C20H14N4O4S |
| Molecular Weight | 406.42 g/mol |
| Exact Mass | 406.07 |
| IUPAC Name | (E)-2-cyano-3-(2-methoxyphenyl)-N-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]prop-2-enamide |
| SMILES | COc1ccccc1/C=C(\C#N)C(=O)Nc1nc(-c2ccc([N+](=O)[O-])cc2)cs1 |
| InChI | InChI=1S/C20H14N4O4S/c1-28-18-5-3-2-4-14(18)10-15(11-21)19(25)23-20-22-17(12-29-20)13-6-8-16(9-7-13)24(26)27/h2-10,12H,1H3,(H,22,23,25)/b15-10+ |
| InChIKey | VSEFBGKJXAWPMF-XNTDXEJSSA-N |
| XLogP | 4.27 |
| TPSA | 118.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.42 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|