C22H18ClN3O2S — CID 19206768
(E)-N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-2-cyano-3-(2-propoxyphenyl)prop-2-enamide (PubChem CID 19206768) has the molecular formula C22H18ClN3O2S and a molecular weight of 423.93 g/mol. Its IUPAC name is (E)-N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-2-cyano-3-(2-propoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-2-cyano-3-(2-propoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 19206768 |
| Molecular Formula | C22H18ClN3O2S |
| Molecular Weight | 423.93 g/mol |
| Exact Mass | 423.08 |
| IUPAC Name | (E)-N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-2-cyano-3-(2-propoxyphenyl)prop-2-enamide |
| SMILES | CCCOc1ccccc1/C=C(\C#N)C(=O)Nc1nc(-c2ccc(Cl)cc2)cs1 |
| InChI | InChI=1S/C22H18ClN3O2S/c1-2-11-28-20-6-4-3-5-16(20)12-17(13-24)21(27)26-22-25-19(14-29-22)15-7-9-18(23)10-8-15/h3-10,12,14H,2,11H2,1H3,(H,25,26,27)/b17-12+ |
| InChIKey | GQMWFVBKRHHBLN-SFQUDFHCSA-N |
| XLogP | 5.80 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.93 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|