C26H23ClN2O4S — CID 4138399
ethyl 4-(4-chlorophenyl)-2-[[2-cyano-3-(2-propoxyphenyl)prop-2-enoyl]amino]thiophene-3-carboxylate (PubChem CID 4138399) has the molecular formula C26H23ClN2O4S and a molecular weight of 495.00 g/mol. Its IUPAC name is ethyl 4-(4-chlorophenyl)-2-[[2-cyano-3-(2-propoxyphenyl)prop-2-enoyl]amino]thiophene-3-carboxylate.
| Compound Name | ethyl 4-(4-chlorophenyl)-2-[[2-cyano-3-(2-propoxyphenyl)prop-2-enoyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 4138399 |
| Molecular Formula | C26H23ClN2O4S |
| Molecular Weight | 495.00 g/mol |
| Exact Mass | 494.11 |
| IUPAC Name | ethyl 4-(4-chlorophenyl)-2-[[2-cyano-3-(2-propoxyphenyl)prop-2-enoyl]amino]thiophene-3-carboxylate |
| SMILES | CCCOc1ccccc1C=C(C#N)C(=O)Nc1scc(-c2ccc(Cl)cc2)c1C(=O)OCC |
| InChI | InChI=1S/C26H23ClN2O4S/c1-3-13-33-22-8-6-5-7-18(22)14-19(15-28)24(30)29-25-23(26(31)32-4-2)21(16-34-25)17-9-11-20(27)12-10-17/h5-12,14,16H,3-4,13H2,1-2H3,(H,29,30) |
| InChIKey | QEDILIGGWHFXEY-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.00 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|