C25H24BrNO4S — CID 5045682
ethyl 4-(4-bromophenyl)-2-[3-(2-propoxyphenyl)prop-2-enoylamino]thiophene-3-carboxylate (PubChem CID 5045682) has the molecular formula C25H24BrNO4S and a molecular weight of 514.44 g/mol. Its IUPAC name is ethyl 4-(4-bromophenyl)-2-[3-(2-propoxyphenyl)prop-2-enoylamino]thiophene-3-carboxylate.
| Compound Name | ethyl 4-(4-bromophenyl)-2-[3-(2-propoxyphenyl)prop-2-enoylamino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 5045682 |
| Molecular Formula | C25H24BrNO4S |
| Molecular Weight | 514.44 g/mol |
| Exact Mass | 513.06 |
| IUPAC Name | ethyl 4-(4-bromophenyl)-2-[3-(2-propoxyphenyl)prop-2-enoylamino]thiophene-3-carboxylate |
| SMILES | CCCOc1ccccc1C=CC(=O)Nc1scc(-c2ccc(Br)cc2)c1C(=O)OCC |
| InChI | InChI=1S/C25H24BrNO4S/c1-3-15-31-21-8-6-5-7-18(21)11-14-22(28)27-24-23(25(29)30-4-2)20(16-32-24)17-9-12-19(26)13-10-17/h5-14,16H,3-4,15H2,1-2H3,(H,27,28) |
| InChIKey | GNNZFRAXUDATLM-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.44 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|