C21H15BrN2O3S2 — CID 6392472
ethyl 4-(4-bromophenyl)-2-[[(E)-2-cyano-3-thiophen-2-ylprop-2-enoyl]amino]thiophene-3-carboxylate (PubChem CID 6392472) has the molecular formula C21H15BrN2O3S2 and a molecular weight of 487.40 g/mol. Its IUPAC name is ethyl 4-(4-bromophenyl)-2-[[(E)-2-cyano-3-thiophen-2-ylprop-2-enoyl]amino]thiophene-3-carboxylate.
| Compound Name | ethyl 4-(4-bromophenyl)-2-[[(E)-2-cyano-3-thiophen-2-ylprop-2-enoyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 6392472 |
| Molecular Formula | C21H15BrN2O3S2 |
| Molecular Weight | 487.40 g/mol |
| Exact Mass | 485.97 |
| IUPAC Name | ethyl 4-(4-bromophenyl)-2-[[(E)-2-cyano-3-thiophen-2-ylprop-2-enoyl]amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(Br)cc2)csc1NC(=O)/C(C#N)=C/c1cccs1 |
| InChI | InChI=1S/C21H15BrN2O3S2/c1-2-27-21(26)18-17(13-5-7-15(22)8-6-13)12-29-20(18)24-19(25)14(11-23)10-16-4-3-9-28-16/h3-10,12H,2H2,1H3,(H,24,25)/b14-10+ |
| InChIKey | GVAUJUDZWQEXSS-GXDHUFHOSA-N |
| XLogP | 5.96 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.40 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|