C15H11BrF3NO3S — CID 4180955
ethyl 4-(4-bromophenyl)-2-[(2,2,2-trifluoroacetyl)amino]thiophene-3-carboxylate (PubChem CID 4180955) has the molecular formula C15H11BrF3NO3S and a molecular weight of 422.22 g/mol. Its IUPAC name is ethyl 4-(4-bromophenyl)-2-[(2,2,2-trifluoroacetyl)amino]thiophene-3-carboxylate.
| Compound Name | ethyl 4-(4-bromophenyl)-2-[(2,2,2-trifluoroacetyl)amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 4180955 |
| Molecular Formula | C15H11BrF3NO3S |
| Molecular Weight | 422.22 g/mol |
| Exact Mass | 420.96 |
| IUPAC Name | ethyl 4-(4-bromophenyl)-2-[(2,2,2-trifluoroacetyl)amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(Br)cc2)csc1NC(=O)C(F)(F)F |
| InChI | InChI=1S/C15H11BrF3NO3S/c1-2-23-13(21)11-10(8-3-5-9(16)6-4-8)7-24-12(11)20-14(22)15(17,18)19/h3-7H,2H2,1H3,(H,20,22) |
| InChIKey | JKZYESAYZFFNIR-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.22 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|