C18H11BrF9NO3S — CID 4549710
ethyl 4-(4-bromophenyl)-2-(2,2,3,3,4,4,5,5,5-nonafluoropentanoylamino)thiophene-3-carboxylate (PubChem CID 4549710) has the molecular formula C18H11BrF9NO3S and a molecular weight of 572.24 g/mol. Its IUPAC name is ethyl 4-(4-bromophenyl)-2-(2,2,3,3,4,4,5,5,5-nonafluoropentanoylamino)thiophene-3-carboxylate.
| Compound Name | ethyl 4-(4-bromophenyl)-2-(2,2,3,3,4,4,5,5,5-nonafluoropentanoylamino)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 4549710 |
| Molecular Formula | C18H11BrF9NO3S |
| Molecular Weight | 572.24 g/mol |
| Exact Mass | 570.95 |
| IUPAC Name | ethyl 4-(4-bromophenyl)-2-(2,2,3,3,4,4,5,5,5-nonafluoropentanoylamino)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(Br)cc2)csc1NC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C18H11BrF9NO3S/c1-2-32-13(30)11-10(8-3-5-9(19)6-4-8)7-33-12(11)29-14(31)15(20,21)16(22,23)17(24,25)18(26,27)28/h3-7H,2H2,1H3,(H,29,31) |
| InChIKey | NMGDTDUFDXJEPM-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.24 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|