C17H9BrF9NO3S — CID 4200950
methyl 4-(4-bromophenyl)-2-(2,2,3,3,4,4,5,5,5-nonafluoropentanoylamino)thiophene-3-carboxylate (PubChem CID 4200950) has the molecular formula C17H9BrF9NO3S and a molecular weight of 558.22 g/mol. Its IUPAC name is methyl 4-(4-bromophenyl)-2-(2,2,3,3,4,4,5,5,5-nonafluoropentanoylamino)thiophene-3-carboxylate.
| Compound Name | methyl 4-(4-bromophenyl)-2-(2,2,3,3,4,4,5,5,5-nonafluoropentanoylamino)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 4200950 |
| Molecular Formula | C17H9BrF9NO3S |
| Molecular Weight | 558.22 g/mol |
| Exact Mass | 556.93 |
| IUPAC Name | methyl 4-(4-bromophenyl)-2-(2,2,3,3,4,4,5,5,5-nonafluoropentanoylamino)thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(-c2ccc(Br)cc2)csc1NC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C17H9BrF9NO3S/c1-31-12(29)10-9(7-2-4-8(18)5-3-7)6-32-11(10)28-13(30)14(19,20)15(21,22)16(23,24)17(25,26)27/h2-6H,1H3,(H,28,30) |
| InChIKey | DUIAZDZROSMTBO-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.22 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|