C19H9BrF5NO3S — CID 4578227
methyl 4-(4-bromophenyl)-2-[(2,3,4,5,6-pentafluorobenzoyl)amino]thiophene-3-carboxylate (PubChem CID 4578227) has the molecular formula C19H9BrF5NO3S and a molecular weight of 506.25 g/mol. Its IUPAC name is methyl 4-(4-bromophenyl)-2-[(2,3,4,5,6-pentafluorobenzoyl)amino]thiophene-3-carboxylate.
| Compound Name | methyl 4-(4-bromophenyl)-2-[(2,3,4,5,6-pentafluorobenzoyl)amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 4578227 |
| Molecular Formula | C19H9BrF5NO3S |
| Molecular Weight | 506.25 g/mol |
| Exact Mass | 504.94 |
| IUPAC Name | methyl 4-(4-bromophenyl)-2-[(2,3,4,5,6-pentafluorobenzoyl)amino]thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(-c2ccc(Br)cc2)csc1NC(=O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C19H9BrF5NO3S/c1-29-19(28)10-9(7-2-4-8(20)5-3-7)6-30-18(10)26-17(27)11-12(21)14(23)16(25)15(24)13(11)22/h2-6H,1H3,(H,26,27) |
| InChIKey | PXLRPVHWPWLKFU-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.25 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|