C19H11BrF3NO4S — CID 87308439
4-(4-bromophenyl)-2-[(2,3,6-trifluoro-4-methoxybenzoyl)amino]thiophene-3-carboxylic acid (PubChem CID 87308439) has the molecular formula C19H11BrF3NO4S and a molecular weight of 486.27 g/mol. Its IUPAC name is 4-(4-bromophenyl)-2-[(2,3,6-trifluoro-4-methoxybenzoyl)amino]thiophene-3-carboxylic acid.
| Compound Name | 4-(4-bromophenyl)-2-[(2,3,6-trifluoro-4-methoxybenzoyl)amino]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 87308439 |
| Molecular Formula | C19H11BrF3NO4S |
| Molecular Weight | 486.27 g/mol |
| Exact Mass | 484.95 |
| IUPAC Name | 4-(4-bromophenyl)-2-[(2,3,6-trifluoro-4-methoxybenzoyl)amino]thiophene-3-carboxylic acid |
| SMILES | COc1cc(F)c(C(=O)Nc2scc(-c3ccc(Br)cc3)c2C(=O)O)c(F)c1F |
| InChI | InChI=1S/C19H11BrF3NO4S/c1-28-12-6-11(21)14(16(23)15(12)22)17(25)24-18-13(19(26)27)10(7-29-18)8-2-4-9(20)5-3-8/h2-7H,1H3,(H,24,25)(H,26,27) |
| InChIKey | BVNNCQHTPNHEGB-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.27 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|