C38H26BrClFIN2O6S2 — CID 87548490
4-(4-bromophenyl)-2-[(4-iodobenzoyl)amino]thiophene-3-carboxylic acid;ethyl 2-[(4-chlorobenzoyl)amino]-4-(4-fluorophenyl)thiophene-3-carboxylate (PubChem CID 87548490) has the molecular formula C38H26BrClFIN2O6S2 and a molecular weight of 932.03 g/mol. Its IUPAC name is 4-(4-bromophenyl)-2-[(4-iodobenzoyl)amino]thiophene-3-carboxylic acid;ethyl 2-[(4-chlorobenzoyl)amino]-4-(4-fluorophenyl)thiophene-3-carboxylate.
| Compound Name | 4-(4-bromophenyl)-2-[(4-iodobenzoyl)amino]thiophene-3-carboxylic acid;ethyl 2-[(4-chlorobenzoyl)amino]-4-(4-fluorophenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 87548490 |
| Molecular Formula | C38H26BrClFIN2O6S2 |
| Molecular Weight | 932.03 g/mol |
| Exact Mass | 929.91 |
| IUPAC Name | 4-(4-bromophenyl)-2-[(4-iodobenzoyl)amino]thiophene-3-carboxylic acid;ethyl 2-[(4-chlorobenzoyl)amino]-4-(4-fluorophenyl)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(F)cc2)csc1NC(=O)c1ccc(Cl)cc1.O=C(Nc1scc(-c2ccc(Br)cc2)c1C(=O)O)c1ccc(I)cc1 |
| InChI | InChI=1S/C20H15ClFNO3S.C18H11BrINO3S/c1-2-26-20(25)17-16(12-5-9-15(22)10-6-12)11-27-19(17)23-18(24)13-3-7-14(21)8-4-13;19-12-5-1-10(2-6-12)14-9-25-17(15(14)18(23)24)21-16(22)11-3-7-13(20)8-4-11/h3-11H,2H2,1H3,(H,23,24);1-9H,(H,21,22)(H,23,24) |
| InChIKey | NJMWTJVNPKBPHN-UHFFFAOYSA-N |
| XLogP | 11.37 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 932.03 |
| LogP ≤ 5 | 11.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|