C26H28FNO6S — CID 3450666
ethyl 4-(4-fluorophenyl)-2-[(3,4,5-triethoxybenzoyl)amino]thiophene-3-carboxylate (PubChem CID 3450666) has the molecular formula C26H28FNO6S and a molecular weight of 501.58 g/mol. Its IUPAC name is ethyl 4-(4-fluorophenyl)-2-[(3,4,5-triethoxybenzoyl)amino]thiophene-3-carboxylate.
| Compound Name | ethyl 4-(4-fluorophenyl)-2-[(3,4,5-triethoxybenzoyl)amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 3450666 |
| Molecular Formula | C26H28FNO6S |
| Molecular Weight | 501.58 g/mol |
| Exact Mass | 501.16 |
| IUPAC Name | ethyl 4-(4-fluorophenyl)-2-[(3,4,5-triethoxybenzoyl)amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(F)cc2)csc1NC(=O)c1cc(OCC)c(OCC)c(OCC)c1 |
| InChI | InChI=1S/C26H28FNO6S/c1-5-31-20-13-17(14-21(32-6-2)23(20)33-7-3)24(29)28-25-22(26(30)34-8-4)19(15-35-25)16-9-11-18(27)12-10-16/h9-15H,5-8H2,1-4H3,(H,28,29) |
| InChIKey | OWKBNWSUSHVKRN-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.58 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|