C23H22FNO6S — CID 2133017
ethyl 4-(4-fluorophenyl)-2-[(3,4,5-trimethoxybenzoyl)amino]thiophene-3-carboxylate (PubChem CID 2133017) has the molecular formula C23H22FNO6S and a molecular weight of 459.50 g/mol. Its IUPAC name is ethyl 4-(4-fluorophenyl)-2-[(3,4,5-trimethoxybenzoyl)amino]thiophene-3-carboxylate.
| Compound Name | ethyl 4-(4-fluorophenyl)-2-[(3,4,5-trimethoxybenzoyl)amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 2133017 |
| Molecular Formula | C23H22FNO6S |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.12 |
| IUPAC Name | ethyl 4-(4-fluorophenyl)-2-[(3,4,5-trimethoxybenzoyl)amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(F)cc2)csc1NC(=O)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C23H22FNO6S/c1-5-31-23(27)19-16(13-6-8-15(24)9-7-13)12-32-22(19)25-21(26)14-10-17(28-2)20(30-4)18(11-14)29-3/h6-12H,5H2,1-4H3,(H,25,26) |
| InChIKey | IEZWOUSPFBZLIH-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|