C24H25NO6S — CID 2205035
ethyl 5-methyl-4-phenyl-2-[(3,4,5-trimethoxybenzoyl)amino]thiophene-3-carboxylate (PubChem CID 2205035) has the molecular formula C24H25NO6S and a molecular weight of 455.53 g/mol. Its IUPAC name is ethyl 5-methyl-4-phenyl-2-[(3,4,5-trimethoxybenzoyl)amino]thiophene-3-carboxylate.
| Compound Name | ethyl 5-methyl-4-phenyl-2-[(3,4,5-trimethoxybenzoyl)amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 2205035 |
| Molecular Formula | C24H25NO6S |
| Molecular Weight | 455.53 g/mol |
| Exact Mass | 455.14 |
| IUPAC Name | ethyl 5-methyl-4-phenyl-2-[(3,4,5-trimethoxybenzoyl)amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)c2cc(OC)c(OC)c(OC)c2)sc(C)c1-c1ccccc1 |
| InChI | InChI=1S/C24H25NO6S/c1-6-31-24(27)20-19(15-10-8-7-9-11-15)14(2)32-23(20)25-22(26)16-12-17(28-3)21(30-5)18(13-16)29-4/h7-13H,6H2,1-5H3,(H,25,26) |
| InChIKey | RLFYBKHBPABLNE-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.53 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|