C23H21NO5S — CID 2921723
4-[(3-ethoxycarbonyl-5-ethyl-4-phenylthiophen-2-yl)carbamoyl]benzoic acid (PubChem CID 2921723) has the molecular formula C23H21NO5S and a molecular weight of 423.49 g/mol. Its IUPAC name is 4-[(3-ethoxycarbonyl-5-ethyl-4-phenylthiophen-2-yl)carbamoyl]benzoic acid.
| Compound Name | 4-[(3-ethoxycarbonyl-5-ethyl-4-phenylthiophen-2-yl)carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 2921723 |
| Molecular Formula | C23H21NO5S |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | 4-[(3-ethoxycarbonyl-5-ethyl-4-phenylthiophen-2-yl)carbamoyl]benzoic acid |
| SMILES | CCOC(=O)c1c(NC(=O)c2ccc(C(=O)O)cc2)sc(CC)c1-c1ccccc1 |
| InChI | InChI=1S/C23H21NO5S/c1-3-17-18(14-8-6-5-7-9-14)19(23(28)29-4-2)21(30-17)24-20(25)15-10-12-16(13-11-15)22(26)27/h5-13H,3-4H2,1-2H3,(H,24,25)(H,26,27) |
| InChIKey | LQWFZHTUWBARCR-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|