C27H23NO3S — CID 3119760
ethyl 2-benzamido-4-benzyl-5-phenylthiophene-3-carboxylate (PubChem CID 3119760) has the molecular formula C27H23NO3S and a molecular weight of 441.55 g/mol. Its IUPAC name is ethyl 2-benzamido-4-benzyl-5-phenylthiophene-3-carboxylate.
| Compound Name | ethyl 2-benzamido-4-benzyl-5-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 3119760 |
| Molecular Formula | C27H23NO3S |
| Molecular Weight | 441.55 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | ethyl 2-benzamido-4-benzyl-5-phenylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)c2ccccc2)sc(-c2ccccc2)c1Cc1ccccc1 |
| InChI | InChI=1S/C27H23NO3S/c1-2-31-27(30)23-22(18-19-12-6-3-7-13-19)24(20-14-8-4-9-15-20)32-26(23)28-25(29)21-16-10-5-11-17-21/h3-17H,2,18H2,1H3,(H,28,29) |
| InChIKey | DNFOUYUSLYCCNP-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.55 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |