C26H27NO5S — CID 28693481
ethyl 2-[(3,4-dimethoxybenzoyl)amino]-4-(5,6,7,8-tetrahydronaphthalen-2-yl)thiophene-3-carboxylate (PubChem CID 28693481) has the molecular formula C26H27NO5S and a molecular weight of 465.57 g/mol. Its IUPAC name is ethyl 2-[(3,4-dimethoxybenzoyl)amino]-4-(5,6,7,8-tetrahydronaphthalen-2-yl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-[(3,4-dimethoxybenzoyl)amino]-4-(5,6,7,8-tetrahydronaphthalen-2-yl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 28693481 |
| Molecular Formula | C26H27NO5S |
| Molecular Weight | 465.57 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | ethyl 2-[(3,4-dimethoxybenzoyl)amino]-4-(5,6,7,8-tetrahydronaphthalen-2-yl)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc3c(c2)CCCC3)csc1NC(=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C26H27NO5S/c1-4-32-26(29)23-20(18-10-9-16-7-5-6-8-17(16)13-18)15-33-25(23)27-24(28)19-11-12-21(30-2)22(14-19)31-3/h9-15H,4-8H2,1-3H3,(H,27,28) |
| InChIKey | RBNVQYWXFHDSMX-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.57 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|