C28H24F2N2O7S2 — CID 3530651
ethyl 2-[[4-[(3,4-difluorophenyl)sulfonylamino]benzoyl]amino]-4-(3,4-dimethoxyphenyl)thiophene-3-carboxylate (PubChem CID 3530651) has the molecular formula C28H24F2N2O7S2 and a molecular weight of 602.64 g/mol. Its IUPAC name is ethyl 2-[[4-[(3,4-difluorophenyl)sulfonylamino]benzoyl]amino]-4-(3,4-dimethoxyphenyl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-[[4-[(3,4-difluorophenyl)sulfonylamino]benzoyl]amino]-4-(3,4-dimethoxyphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 3530651 |
| Molecular Formula | C28H24F2N2O7S2 |
| Molecular Weight | 602.64 g/mol |
| Exact Mass | 602.10 |
| IUPAC Name | ethyl 2-[[4-[(3,4-difluorophenyl)sulfonylamino]benzoyl]amino]-4-(3,4-dimethoxyphenyl)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(OC)c(OC)c2)csc1NC(=O)c1ccc(NS(=O)(=O)c2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C28H24F2N2O7S2/c1-4-39-28(34)25-20(17-7-12-23(37-2)24(13-17)38-3)15-40-27(25)31-26(33)16-5-8-18(9-6-16)32-41(35,36)19-10-11-21(29)22(30)14-19/h5-15,32H,4H2,1-3H3,(H,31,33) |
| InChIKey | AUPTUOFLBLFYMG-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.64 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|