C22H21NO4S — CID 995603
ethyl 2-[(4-methoxybenzoyl)amino]-4-(3-methylphenyl)thiophene-3-carboxylate (PubChem CID 995603) has the molecular formula C22H21NO4S and a molecular weight of 395.48 g/mol. Its IUPAC name is ethyl 2-[(4-methoxybenzoyl)amino]-4-(3-methylphenyl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-[(4-methoxybenzoyl)amino]-4-(3-methylphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 995603 |
| Molecular Formula | C22H21NO4S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | ethyl 2-[(4-methoxybenzoyl)amino]-4-(3-methylphenyl)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2cccc(C)c2)csc1NC(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C22H21NO4S/c1-4-27-22(25)19-18(16-7-5-6-14(2)12-16)13-28-21(19)23-20(24)15-8-10-17(26-3)11-9-15/h5-13H,4H2,1-3H3,(H,23,24) |
| InChIKey | QNHOWBRDDYACRX-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|