C25H27NO3S — CID 2071972
ethyl 4-(2,4-dimethylphenyl)-2-[(4-propan-2-ylbenzoyl)amino]thiophene-3-carboxylate (PubChem CID 2071972) has the molecular formula C25H27NO3S and a molecular weight of 421.56 g/mol. Its IUPAC name is ethyl 4-(2,4-dimethylphenyl)-2-[(4-propan-2-ylbenzoyl)amino]thiophene-3-carboxylate.
| Compound Name | ethyl 4-(2,4-dimethylphenyl)-2-[(4-propan-2-ylbenzoyl)amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 2071972 |
| Molecular Formula | C25H27NO3S |
| Molecular Weight | 421.56 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | ethyl 4-(2,4-dimethylphenyl)-2-[(4-propan-2-ylbenzoyl)amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(C)cc2C)csc1NC(=O)c1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C25H27NO3S/c1-6-29-25(28)22-21(20-12-7-16(4)13-17(20)5)14-30-24(22)26-23(27)19-10-8-18(9-11-19)15(2)3/h7-15H,6H2,1-5H3,(H,26,27) |
| InChIKey | DQDJVSFXMDPCRZ-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.56 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|