C22H22N2O3S — CID 997609
propan-2-yl 4-(2,4-dimethylphenyl)-2-(pyridine-4-carbonylamino)thiophene-3-carboxylate (PubChem CID 997609) has the molecular formula C22H22N2O3S and a molecular weight of 394.50 g/mol. Its IUPAC name is propan-2-yl 4-(2,4-dimethylphenyl)-2-(pyridine-4-carbonylamino)thiophene-3-carboxylate.
| Compound Name | propan-2-yl 4-(2,4-dimethylphenyl)-2-(pyridine-4-carbonylamino)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 997609 |
| Molecular Formula | C22H22N2O3S |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | propan-2-yl 4-(2,4-dimethylphenyl)-2-(pyridine-4-carbonylamino)thiophene-3-carboxylate |
| SMILES | Cc1ccc(-c2csc(NC(=O)c3ccncc3)c2C(=O)OC(C)C)c(C)c1 |
| InChI | InChI=1S/C22H22N2O3S/c1-13(2)27-22(26)19-18(17-6-5-14(3)11-15(17)4)12-28-21(19)24-20(25)16-7-9-23-10-8-16/h5-13H,1-4H3,(H,24,25) |
| InChIKey | GUYLNYVBGZHNNR-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|